C26H22Cl3N3OS — CID 3566106
3-chloro-N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 3566106) has the molecular formula C26H22Cl3N3OS and a molecular weight of 530.91 g/mol. Its IUPAC name is 3-chloro-N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3566106 |
| Molecular Formula | C26H22Cl3N3OS |
| Molecular Weight | 530.91 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | 3-chloro-N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)c(Cl)c1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C26H22Cl3N3OS/c27-20-7-3-1-5-17(20)16-31-11-13-32(14-12-31)22-10-9-18(15-21(22)28)30-26(33)25-24(29)19-6-2-4-8-23(19)34-25/h1-10,15H,11-14,16H2,(H,30,33) |
| InChIKey | PIOKRKMWOOCIHZ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.91 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|