C21H22ClN3OS — CID 46534358
3-chloro-N-[2-(4-ethylpiperazin-1-yl)phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 46534358) has the molecular formula C21H22ClN3OS and a molecular weight of 399.95 g/mol. Its IUPAC name is 3-chloro-N-[2-(4-ethylpiperazin-1-yl)phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-(4-ethylpiperazin-1-yl)phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 46534358 |
| Molecular Formula | C21H22ClN3OS |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 3-chloro-N-[2-(4-ethylpiperazin-1-yl)phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | CCN1CCN(c2ccccc2NC(=O)c2sc3ccccc3c2Cl)CC1 |
| InChI | InChI=1S/C21H22ClN3OS/c1-2-24-11-13-25(14-12-24)17-9-5-4-8-16(17)23-21(26)20-19(22)15-7-3-6-10-18(15)27-20/h3-10H,2,11-14H2,1H3,(H,23,26) |
| InChIKey | OQWZOUYCPKNPIE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |