C24H23ClN4O3S — CID 35397504
3-chloro-N-(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)-1-benzothiophene-2-carboxamide (PubChem CID 35397504) has the molecular formula C24H23ClN4O3S and a molecular weight of 482.99 g/mol. Its IUPAC name is 3-chloro-N-(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 35397504 |
| Molecular Formula | C24H23ClN4O3S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 3-chloro-N-(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)-1-benzothiophene-2-carboxamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(N3CCCCC3)c(NC(=O)c3sc4ccccc4c3Cl)cc21 |
| InChI | InChI=1S/C24H23ClN4O3S/c1-27-17-12-15(26-22(30)21-20(25)14-8-4-5-9-19(14)33-21)16(29-10-6-3-7-11-29)13-18(17)28(2)24(32)23(27)31/h4-5,8-9,12-13H,3,6-7,10-11H2,1-2H3,(H,26,30) |
| InChIKey | OCHJHPZLECGXDN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|