C19H20N4O4 — CID 22433222
N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)furan-2-carboxamide (PubChem CID 22433222) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)furan-2-carboxamide.
| Compound Name | N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 22433222 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-(1,4-dimethyl-2,3-dioxo-7-pyrrolidin-1-ylquinoxalin-6-yl)furan-2-carboxamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(N3CCCC3)c(NC(=O)c3ccco3)cc21 |
| InChI | InChI=1S/C19H20N4O4/c1-21-14-10-12(20-17(24)16-6-5-9-27-16)13(23-7-3-4-8-23)11-15(14)22(2)19(26)18(21)25/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,20,24) |
| InChIKey | DIAGZGRXQSGDCL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|