C22H19N3O6 — CID 46341405
N-[7-(4-methoxyphenoxy)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]furan-2-carboxamide (PubChem CID 46341405) has the molecular formula C22H19N3O6 and a molecular weight of 421.41 g/mol. Its IUPAC name is N-[7-(4-methoxyphenoxy)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]furan-2-carboxamide.
| Compound Name | N-[7-(4-methoxyphenoxy)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46341405 |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-[7-(4-methoxyphenoxy)-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl]furan-2-carboxamide |
| SMILES | COc1ccc(Oc2cc3c(cc2NC(=O)c2ccco2)n(C)c(=O)c(=O)n3C)cc1 |
| InChI | InChI=1S/C22H19N3O6/c1-24-16-11-15(23-20(26)18-5-4-10-30-18)19(12-17(16)25(2)22(28)21(24)27)31-14-8-6-13(29-3)7-9-14/h4-12H,1-3H3,(H,23,26) |
| InChIKey | XNSPSVHAFIUHPZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|