C20H18N2O4 — CID 25250119
N-[2-[(4-methoxybenzoyl)amino]-4-methylphenyl]furan-2-carboxamide (PubChem CID 25250119) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is N-[2-[(4-methoxybenzoyl)amino]-4-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[2-[(4-methoxybenzoyl)amino]-4-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25250119 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[2-[(4-methoxybenzoyl)amino]-4-methylphenyl]furan-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cc(C)ccc2NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C20H18N2O4/c1-13-5-10-16(21-20(24)18-4-3-11-26-18)17(12-13)22-19(23)14-6-8-15(25-2)9-7-14/h3-12H,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | QZTYYFBRXKHABW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |