C22H21NO6 — CID 4803837
2-(4-methoxyphenoxy)ethyl 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 4803837) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 4803837 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | COc1ccc(OCCOC(=O)c2ccc(C)c(NC(=O)c3ccco3)c2)cc1 |
| InChI | InChI=1S/C22H21NO6/c1-15-5-6-16(14-19(15)23-21(24)20-4-3-11-28-20)22(25)29-13-12-27-18-9-7-17(26-2)8-10-18/h3-11,14H,12-13H2,1-2H3,(H,23,24) |
| InChIKey | BXIVCFCTBHCZGP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|