C21H15Cl3N2O5 — CID 2357454
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 2357454) has the molecular formula C21H15Cl3N2O5 and a molecular weight of 481.72 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 2357454 |
| Molecular Formula | C21H15Cl3N2O5 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C21H15Cl3N2O5/c1-11-4-5-12(7-16(11)26-20(28)18-3-2-6-30-18)21(29)31-10-19(27)25-17-9-14(23)13(22)8-15(17)24/h2-9H,10H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | VFZDMFSNITUFID-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|