C18H19NO6 — CID 24557608
(2-oxo-2-propan-2-yloxyethyl) 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 24557608) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is (2-oxo-2-propan-2-yloxyethyl) 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | (2-oxo-2-propan-2-yloxyethyl) 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 24557608 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (2-oxo-2-propan-2-yloxyethyl) 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)OC(C)C)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H19NO6/c1-11(2)25-16(20)10-24-18(22)13-7-6-12(3)14(9-13)19-17(21)15-5-4-8-23-15/h4-9,11H,10H2,1-3H3,(H,19,21) |
| InChIKey | ABJXPALJFLVLTJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |