C16H14N2O4 — CID 2605458
[(1R)-1-cyanoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 2605458) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | [(1R)-1-cyanoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 2605458 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | [(1R)-1-cyanoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@H](C)C#N)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C16H14N2O4/c1-10-5-6-12(16(20)22-11(2)9-17)8-13(10)18-15(19)14-4-3-7-21-14/h3-8,11H,1-2H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | LTJSNWCDEXRWHY-LLVKDONJSA-N |
| XLogP | 2.91 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |