C24H25NO4 — CID 7846624
(4-tert-butylphenyl)methyl 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 7846624) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | (4-tert-butylphenyl)methyl 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 7846624 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (4-tert-butylphenyl)methyl 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2ccc(C(C)(C)C)cc2)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C24H25NO4/c1-16-7-10-18(14-20(16)25-22(26)21-6-5-13-28-21)23(27)29-15-17-8-11-19(12-9-17)24(2,3)4/h5-14H,15H2,1-4H3,(H,25,26) |
| InChIKey | DUPMQYHLRBNOPD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |