C21H16BrNO5 — CID 4801787
[2-(4-bromophenyl)-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 4801787) has the molecular formula C21H16BrNO5 and a molecular weight of 442.27 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 4801787 |
| Molecular Formula | C21H16BrNO5 |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)c2ccc(Br)cc2)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C21H16BrNO5/c1-13-4-5-15(11-17(13)23-20(25)19-3-2-10-27-19)21(26)28-12-18(24)14-6-8-16(22)9-7-14/h2-11H,12H2,1H3,(H,23,25) |
| InChIKey | JJPHCECCVFXZGK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |