C22H18FNO6 — CID 7544411
[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 7544411) has the molecular formula C22H18FNO6 and a molecular weight of 411.39 g/mol. Its IUPAC name is [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 7544411 |
| Molecular Formula | C22H18FNO6 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(C)c(NC(=O)c3ccco3)c2)cc1F |
| InChI | InChI=1S/C22H18FNO6/c1-13-5-6-15(11-17(13)24-21(26)20-4-3-9-29-20)22(27)30-12-18(25)14-7-8-19(28-2)16(23)10-14/h3-11H,12H2,1-2H3,(H,24,26) |
| InChIKey | FPOZTFODWQMDDR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |