C18H18FNO4 — CID 100612781
ethyl 3-[(3-fluoro-4-methoxybenzoyl)amino]-4-methylbenzoate (PubChem CID 100612781) has the molecular formula C18H18FNO4 and a molecular weight of 331.34 g/mol. Its IUPAC name is ethyl 3-[(3-fluoro-4-methoxybenzoyl)amino]-4-methylbenzoate.
| Compound Name | ethyl 3-[(3-fluoro-4-methoxybenzoyl)amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 100612781 |
| Molecular Formula | C18H18FNO4 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | ethyl 3-[(3-fluoro-4-methoxybenzoyl)amino]-4-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C)c(NC(=O)c2ccc(OC)c(F)c2)c1 |
| InChI | InChI=1S/C18H18FNO4/c1-4-24-18(22)13-6-5-11(2)15(10-13)20-17(21)12-7-8-16(23-3)14(19)9-12/h5-10H,4H2,1-3H3,(H,20,21) |
| InChIKey | WUWLWPSISCGPHM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |