C16H13F2NO3 — CID 8919868
methyl 3-[(3,5-difluorobenzoyl)amino]-4-methylbenzoate (PubChem CID 8919868) has the molecular formula C16H13F2NO3 and a molecular weight of 305.28 g/mol. Its IUPAC name is methyl 3-[(3,5-difluorobenzoyl)amino]-4-methylbenzoate.
| Compound Name | methyl 3-[(3,5-difluorobenzoyl)amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 8919868 |
| Molecular Formula | C16H13F2NO3 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | methyl 3-[(3,5-difluorobenzoyl)amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C16H13F2NO3/c1-9-3-4-10(16(21)22-2)7-14(9)19-15(20)11-5-12(17)8-13(18)6-11/h3-8H,1-2H3,(H,19,20) |
| InChIKey | NZDAGANTZYDXPR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |