C16H11F4NO3 — CID 7920475
methyl 4-methyl-3-[(2,3,4,5-tetrafluorobenzoyl)amino]benzoate (PubChem CID 7920475) has the molecular formula C16H11F4NO3 and a molecular weight of 341.26 g/mol. Its IUPAC name is methyl 4-methyl-3-[(2,3,4,5-tetrafluorobenzoyl)amino]benzoate.
| Compound Name | methyl 4-methyl-3-[(2,3,4,5-tetrafluorobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 7920475 |
| Molecular Formula | C16H11F4NO3 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | methyl 4-methyl-3-[(2,3,4,5-tetrafluorobenzoyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)c2cc(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C16H11F4NO3/c1-7-3-4-8(16(23)24-2)5-11(7)21-15(22)9-6-10(17)13(19)14(20)12(9)18/h3-6H,1-2H3,(H,21,22) |
| InChIKey | UDNJWKCZRLYYLD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|