C19H19NO5 — CID 4228000
dimethyl 2-[(3,4-dimethylbenzoyl)amino]benzene-1,4-dicarboxylate (PubChem CID 4228000) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is dimethyl 2-[(3,4-dimethylbenzoyl)amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(3,4-dimethylbenzoyl)amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 4228000 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | dimethyl 2-[(3,4-dimethylbenzoyl)amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C19H19NO5/c1-11-5-6-13(9-12(11)2)17(21)20-16-10-14(18(22)24-3)7-8-15(16)19(23)25-4/h5-10H,1-4H3,(H,20,21) |
| InChIKey | ADOSRPWHFQDVGM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |