C17H13Cl2NO5 — CID 1279607
dimethyl 2-[(2,5-dichlorobenzoyl)amino]benzene-1,4-dicarboxylate (PubChem CID 1279607) has the molecular formula C17H13Cl2NO5 and a molecular weight of 382.20 g/mol. Its IUPAC name is dimethyl 2-[(2,5-dichlorobenzoyl)amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(2,5-dichlorobenzoyl)amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 1279607 |
| Molecular Formula | C17H13Cl2NO5 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | dimethyl 2-[(2,5-dichlorobenzoyl)amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C17H13Cl2NO5/c1-24-16(22)9-3-5-11(17(23)25-2)14(7-9)20-15(21)12-8-10(18)4-6-13(12)19/h3-8H,1-2H3,(H,20,21) |
| InChIKey | WKHZDFXXVNGQBR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |