2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid

C18H15NO7 — CID 7209741

IUPAC2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid
SMILESCOC(=O)c1ccc(C(=O)OC)c(NC(=O)c2ccccc2C(=O)O)c1
InChIInChI=1S/C18H15NO7/c1-25-17(23)10-7-8-13(18(24)26-2)14(9-10)19-15(20)11-5-3-4-6-12(11)16(21)22/h3-9H,1-2H3,(H,19,20)(H,21,22)
InChIKeyBMPDCNMVHSRXKO-UHFFFAOYSA-N
MW357.32 g/mol
LogP2.21
Rot. Bonds5

About 2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid

2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid (PubChem CID 7209741) has the molecular formula C18H15NO7 and a molecular weight of 357.32 g/mol. Its IUPAC name is 2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid.

Molecular Properties

Compound Name2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid
PubChem CID7209741
Molecular FormulaC18H15NO7
Molecular Weight357.32 g/mol
Exact Mass357.08
IUPAC Name2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid
SMILESCOC(=O)c1ccc(C(=O)OC)c(NC(=O)c2ccccc2C(=O)O)c1
InChIInChI=1S/C18H15NO7/c1-25-17(23)10-7-8-13(18(24)26-2)14(9-10)19-15(20)11-5-3-4-6-12(11)16(21)22/h3-9H,1-2H3,(H,19,20)(H,21,22)
InChIKeyBMPDCNMVHSRXKO-UHFFFAOYSA-N
XLogP2.21
TPSA119.00 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500357.32
LogP ≤ 52.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid?
The IUPAC name of 2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid (CID 7209741) is 2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid.
What is the SMILES notation for 2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid?
The canonical SMILES for 2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid is COC(=O)c1ccc(C(=O)OC)c(NC(=O)c2ccccc2C(=O)O)c1.
What is the InChIKey of 2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid?
The InChIKey is BMPDCNMVHSRXKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO7/c1-25-17(23)10-7-8-13(18(24)26-2)14(9-10)19-15(20)11-5-3-4-6-12(11)16(21)22/h3-9H,1-2H3,(H,19,20)(H,21,22).
What are the key properties of 2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid?
2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid has a molecular weight of 357.32 g/mol, XLogP of 2.21, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoic acid is sourced from PubChem (CID 7209741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).