C20H21NO7S — CID 17224739
dimethyl 2-[(2-propylsulfonylbenzoyl)amino]benzene-1,4-dicarboxylate (PubChem CID 17224739) has the molecular formula C20H21NO7S and a molecular weight of 419.46 g/mol. Its IUPAC name is dimethyl 2-[(2-propylsulfonylbenzoyl)amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(2-propylsulfonylbenzoyl)amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 17224739 |
| Molecular Formula | C20H21NO7S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | dimethyl 2-[(2-propylsulfonylbenzoyl)amino]benzene-1,4-dicarboxylate |
| SMILES | CCCS(=O)(=O)c1ccccc1C(=O)Nc1cc(C(=O)OC)ccc1C(=O)OC |
| InChI | InChI=1S/C20H21NO7S/c1-4-11-29(25,26)17-8-6-5-7-15(17)18(22)21-16-12-13(19(23)27-2)9-10-14(16)20(24)28-3/h5-10,12H,4,11H2,1-3H3,(H,21,22) |
| InChIKey | MLSODMBBJSMQDI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |