C20H23NO5S — CID 17224802
propyl 4-[(2-propylsulfonylbenzoyl)amino]benzoate (PubChem CID 17224802) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is propyl 4-[(2-propylsulfonylbenzoyl)amino]benzoate.
| Compound Name | propyl 4-[(2-propylsulfonylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 17224802 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | propyl 4-[(2-propylsulfonylbenzoyl)amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)c2ccccc2S(=O)(=O)CCC)cc1 |
| InChI | InChI=1S/C20H23NO5S/c1-3-13-26-20(23)15-9-11-16(12-10-15)21-19(22)17-7-5-6-8-18(17)27(24,25)14-4-2/h5-12H,3-4,13-14H2,1-2H3,(H,21,22) |
| InChIKey | UWFPAICUKJZFDC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |