C16H21NO5 — CID 4686078
dimethyl 2-(hexanoylamino)benzene-1,4-dicarboxylate (PubChem CID 4686078) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is dimethyl 2-(hexanoylamino)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(hexanoylamino)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 4686078 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | dimethyl 2-(hexanoylamino)benzene-1,4-dicarboxylate |
| SMILES | CCCCCC(=O)Nc1cc(C(=O)OC)ccc1C(=O)OC |
| InChI | InChI=1S/C16H21NO5/c1-4-5-6-7-14(18)17-13-10-11(15(19)21-2)8-9-12(13)16(20)22-3/h8-10H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | NNJXGOWXKHETDY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|