C19H21N2O5+ — CID 8857832
dimethyl 2-[[2-(4-ethylpyridin-1-ium-1-yl)acetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 8857832) has the molecular formula C19H21N2O5+ and a molecular weight of 357.39 g/mol. Its IUPAC name is dimethyl 2-[[2-(4-ethylpyridin-1-ium-1-yl)acetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(4-ethylpyridin-1-ium-1-yl)acetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 8857832 |
| Molecular Formula | C19H21N2O5+ |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | dimethyl 2-[[2-(4-ethylpyridin-1-ium-1-yl)acetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | CCc1cc[n+](CC(=O)Nc2cc(C(=O)OC)ccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C19H20N2O5/c1-4-13-7-9-21(10-8-13)12-17(22)20-16-11-14(18(23)25-2)5-6-15(16)19(24)26-3/h5-11H,4,12H2,1-3H3/p+1 |
| InChIKey | FFTUKZXMBXXCCZ-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|