C18H18N3O6+ — CID 8854240
dimethyl 2-[[2-(3-carbamoylpyridin-1-ium-1-yl)acetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 8854240) has the molecular formula C18H18N3O6+ and a molecular weight of 372.36 g/mol. Its IUPAC name is dimethyl 2-[[2-(3-carbamoylpyridin-1-ium-1-yl)acetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(3-carbamoylpyridin-1-ium-1-yl)acetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 8854240 |
| Molecular Formula | C18H18N3O6+ |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | dimethyl 2-[[2-(3-carbamoylpyridin-1-ium-1-yl)acetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)C[n+]2cccc(C(N)=O)c2)c1 |
| InChI | InChI=1S/C18H17N3O6/c1-26-17(24)11-5-6-13(18(25)27-2)14(8-11)20-15(22)10-21-7-3-4-12(9-21)16(19)23/h3-9H,10H2,1-2H3,(H2-,19,20,22,23,25)/p+1 |
| InChIKey | OBSJMYWVVJLFDE-UHFFFAOYSA-O |
| XLogP | 0.28 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|