C15H12Cl2F3N3O2 — CID 18285363
1-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]pyridin-1-ium-3-carboxamide chloride (PubChem CID 18285363) has the molecular formula C15H12Cl2F3N3O2 and a molecular weight of 394.18 g/mol. Its IUPAC name is 1-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]pyridin-1-ium-3-carboxamide chloride.
| Compound Name | 1-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]pyridin-1-ium-3-carboxamide chloride |
|---|---|
| PubChem CID | 18285363 |
| Molecular Formula | C15H12Cl2F3N3O2 |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 1-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]pyridin-1-ium-3-carboxamide chloride |
| SMILES | NC(=O)c1ccc[n+](CC(=O)Nc2cc(C(F)(F)F)ccc2Cl)c1.[Cl-] |
| InChI | InChI=1S/C15H11ClF3N3O2.ClH/c16-11-4-3-10(15(17,18)19)6-12(11)21-13(23)8-22-5-1-2-9(7-22)14(20)24;/h1-7H,8H2,(H2-,20,21,23,24);1H |
| InChIKey | QBMQSYWMPAGUTG-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|