C23H22Cl2F6N2O2 — CID 54787319
N,N'-bis[2-chloro-5-(trifluoromethyl)phenyl]nonanediamide (PubChem CID 54787319) has the molecular formula C23H22Cl2F6N2O2 and a molecular weight of 543.34 g/mol. Its IUPAC name is N,N'-bis[2-chloro-5-(trifluoromethyl)phenyl]nonanediamide.
| Compound Name | N,N'-bis[2-chloro-5-(trifluoromethyl)phenyl]nonanediamide |
|---|---|
| PubChem CID | 54787319 |
| Molecular Formula | C23H22Cl2F6N2O2 |
| Molecular Weight | 543.34 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | N,N'-bis[2-chloro-5-(trifluoromethyl)phenyl]nonanediamide |
| SMILES | O=C(CCCCCCCC(=O)Nc1cc(C(F)(F)F)ccc1Cl)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C23H22Cl2F6N2O2/c24-16-10-8-14(22(26,27)28)12-18(16)32-20(34)6-4-2-1-3-5-7-21(35)33-19-13-15(23(29,30)31)9-11-17(19)25/h8-13H,1-7H2,(H,32,34)(H,33,35) |
| InChIKey | CJEBBCMYFWAUCP-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.34 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|