C11H8ClF3NO4- — CID 7407565
2-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethoxy]acetate (PubChem CID 7407565) has the molecular formula C11H8ClF3NO4- and a molecular weight of 310.64 g/mol. Its IUPAC name is 2-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethoxy]acetate.
| Compound Name | 2-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 7407565 |
| Molecular Formula | C11H8ClF3NO4- |
| Molecular Weight | 310.64 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethoxy]acetate |
| SMILES | O=C([O-])COCC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H9ClF3NO4/c12-7-2-1-6(11(13,14)15)3-8(7)16-9(17)4-20-5-10(18)19/h1-3H,4-5H2,(H,16,17)(H,18,19)/p-1 |
| InChIKey | HWKIJASQYAMDMK-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.64 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |