C18H16ClF3N2O3 — CID 7668422
[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-(dimethylamino)benzoate (PubChem CID 7668422) has the molecular formula C18H16ClF3N2O3 and a molecular weight of 400.78 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-(dimethylamino)benzoate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 7668422 |
| Molecular Formula | C18H16ClF3N2O3 |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 4-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(C(=O)OCC(=O)Nc2cc(C(F)(F)F)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H16ClF3N2O3/c1-24(2)13-6-3-11(4-7-13)17(26)27-10-16(25)23-15-9-12(18(20,21)22)5-8-14(15)19/h3-9H,10H2,1-2H3,(H,23,25) |
| InChIKey | MDCGQNVCCXXYCB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |