C14H9ClF3NO4 — CID 2631675
[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] furan-2-carboxylate (PubChem CID 2631675) has the molecular formula C14H9ClF3NO4 and a molecular weight of 347.68 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2631675 |
| Molecular Formula | C14H9ClF3NO4 |
| Molecular Weight | 347.68 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccco1)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C14H9ClF3NO4/c15-9-4-3-8(14(16,17)18)6-10(9)19-12(20)7-23-13(21)11-2-1-5-22-11/h1-6H,7H2,(H,19,20) |
| InChIKey | LQMNESDSENBHTI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.68 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |