C20H13ClF3NO5 — CID 2423223
[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 2423223) has the molecular formula C20H13ClF3NO5 and a molecular weight of 439.77 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 2423223 |
| Molecular Formula | C20H13ClF3NO5 |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(O)c2ccccc2c1O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C20H13ClF3NO5/c21-14-6-5-10(20(22,23)24)7-15(14)25-17(27)9-30-19(29)13-8-16(26)11-3-1-2-4-12(11)18(13)28/h1-8,26,28H,9H2,(H,25,27) |
| InChIKey | ZFEBRHKCFWWUFK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|