C22H19NO7 — CID 7553379
[2-(4-ethoxycarbonylanilino)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 7553379) has the molecular formula C22H19NO7 and a molecular weight of 409.39 g/mol. Its IUPAC name is [2-(4-ethoxycarbonylanilino)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [2-(4-ethoxycarbonylanilino)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7553379 |
| Molecular Formula | C22H19NO7 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [2-(4-ethoxycarbonylanilino)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)c2cc(O)c3ccccc3c2O)cc1 |
| InChI | InChI=1S/C22H19NO7/c1-2-29-21(27)13-7-9-14(10-8-13)23-19(25)12-30-22(28)17-11-18(24)15-5-3-4-6-16(15)20(17)26/h3-11,24,26H,2,12H2,1H3,(H,23,25) |
| InChIKey | YLXVIEHFVCCPJX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|