C21H18O5 — CID 7228493
[2-(4-ethylphenyl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 7228493) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [2-(4-ethylphenyl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7228493 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | [2-(4-ethylphenyl)-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | CCc1ccc(C(=O)COC(=O)c2cc(O)c3ccccc3c2O)cc1 |
| InChI | InChI=1S/C21H18O5/c1-2-13-7-9-14(10-8-13)19(23)12-26-21(25)17-11-18(22)15-5-3-4-6-16(15)20(17)24/h3-11,22,24H,2,12H2,1H3 |
| InChIKey | PBSCAUZJFLPBLI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|