C13H12O5 — CID 156840191
2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 156840191) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 156840191 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | O=C(OCCO)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C13H12O5/c14-5-6-18-13(17)10-7-11(15)8-3-1-2-4-9(8)12(10)16/h1-4,7,14-16H,5-6H2 |
| InChIKey | CKMBNAPQRXBYNS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|