2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate

C13H12O5 — CID 156840191

IUPAC2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate
SMILESO=C(OCCO)c1cc(O)c2ccccc2c1O
InChIInChI=1S/C13H12O5/c14-5-6-18-13(17)10-7-11(15)8-3-1-2-4-9(8)12(10)16/h1-4,7,14-16H,5-6H2
InChIKeyCKMBNAPQRXBYNS-UHFFFAOYSA-N
MW248.23 g/mol
LogP1.40
Rot. Bonds3

About 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate

2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 156840191) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate.

Molecular Properties

Compound Name2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate
PubChem CID156840191
Molecular FormulaC13H12O5
Molecular Weight248.23 g/mol
Exact Mass248.07
IUPAC Name2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate
SMILESO=C(OCCO)c1cc(O)c2ccccc2c1O
InChIInChI=1S/C13H12O5/c14-5-6-18-13(17)10-7-11(15)8-3-1-2-4-9(8)12(10)16/h1-4,7,14-16H,5-6H2
InChIKeyCKMBNAPQRXBYNS-UHFFFAOYSA-N
XLogP1.40
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.23
LogP ≤ 51.40
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydroquinone', 'substructure': 'N/A'}

Analyze 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate?
The IUPAC name of 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate (CID 156840191) is 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate.
What is the SMILES notation for 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate?
The canonical SMILES for 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate is O=C(OCCO)c1cc(O)c2ccccc2c1O.
What is the InChIKey of 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate?
The InChIKey is CKMBNAPQRXBYNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O5/c14-5-6-18-13(17)10-7-11(15)8-3-1-2-4-9(8)12(10)16/h1-4,7,14-16H,5-6H2.
What are the key properties of 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate?
2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate has a molecular weight of 248.23 g/mol, XLogP of 1.40, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 1,4-dihydroxynaphthalene-2-carboxylate is sourced from PubChem (CID 156840191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).