C19H13NO4 — CID 5132964
(4-cyanophenyl)methyl 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 5132964) has the molecular formula C19H13NO4 and a molecular weight of 319.32 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | (4-cyanophenyl)methyl 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 5132964 |
| Molecular Formula | C19H13NO4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (4-cyanophenyl)methyl 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | N#Cc1ccc(COC(=O)c2cc(O)c3ccccc3c2O)cc1 |
| InChI | InChI=1S/C19H13NO4/c20-10-12-5-7-13(8-6-12)11-24-19(23)16-9-17(21)14-3-1-2-4-15(14)18(16)22/h1-9,21-22H,11H2 |
| InChIKey | MBTOICXTRKRVLT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|