About (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate
(4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate (PubChem CID 4562658) has the molecular formula C23H19NO4
and a molecular weight of 373.41 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate |
| PubChem CID | 4562658 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate |
| SMILES | N#Cc1ccc(COC(=O)c2ccccc2OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO4/c24-16-18-10-12-19(13-11-18)17-28-23(25)21-8-4-5-9-22(21)27-15-14-26-20-6-2-1-3-7-20/h1-13H,14-15,17H2 |
| InChIKey | TXGXNOMKPXNCCV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate?
The IUPAC name of (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate (CID 4562658) is (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate.
What is the SMILES notation for (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate?
The canonical SMILES for (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate is N#Cc1ccc(COC(=O)c2ccccc2OCCOc2ccccc2)cc1.
What is the InChIKey of (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate?
The InChIKey is TXGXNOMKPXNCCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO4/c24-16-18-10-12-19(13-11-18)17-28-23(25)21-8-4-5-9-22(21)27-15-14-26-20-6-2-1-3-7-20/h1-13H,14-15,17H2.
What are the key properties of (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate?
(4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate has a molecular weight of 373.41 g/mol, XLogP of 4.37, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 2-(2-phenoxyethoxy)benzoate is sourced from PubChem (CID 4562658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).