C17H15NO2S — CID 8658159
(4-cyanophenyl)methyl 2-ethylsulfanylbenzoate (PubChem CID 8658159) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-ethylsulfanylbenzoate.
| Compound Name | (4-cyanophenyl)methyl 2-ethylsulfanylbenzoate |
|---|---|
| PubChem CID | 8658159 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (4-cyanophenyl)methyl 2-ethylsulfanylbenzoate |
| SMILES | CCSc1ccccc1C(=O)OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H15NO2S/c1-2-21-16-6-4-3-5-15(16)17(19)20-12-14-9-7-13(11-18)8-10-14/h3-10H,2,12H2,1H3 |
| InChIKey | NDCBCWCDECYGCE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |