C22H24N2O3S — CID 7624332
[2-(3-methylbutylamino)-2-oxoethyl] 2-[(4-cyanophenyl)methylsulfanyl]benzoate (PubChem CID 7624332) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is [2-(3-methylbutylamino)-2-oxoethyl] 2-[(4-cyanophenyl)methylsulfanyl]benzoate.
| Compound Name | [2-(3-methylbutylamino)-2-oxoethyl] 2-[(4-cyanophenyl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 7624332 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [2-(3-methylbutylamino)-2-oxoethyl] 2-[(4-cyanophenyl)methylsulfanyl]benzoate |
| SMILES | CC(C)CCNC(=O)COC(=O)c1ccccc1SCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H24N2O3S/c1-16(2)11-12-24-21(25)14-27-22(26)19-5-3-4-6-20(19)28-15-18-9-7-17(13-23)8-10-18/h3-10,16H,11-12,14-15H2,1-2H3,(H,24,25) |
| InChIKey | PHTAYYKREGPRJU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |