C18H18N2OS — CID 30878901
2-[(4-cyanophenyl)methylsulfanyl]-N-propylbenzamide (PubChem CID 30878901) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfanyl]-N-propylbenzamide.
| Compound Name | 2-[(4-cyanophenyl)methylsulfanyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 30878901 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfanyl]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccccc1SCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H18N2OS/c1-2-11-20-18(21)16-5-3-4-6-17(16)22-13-15-9-7-14(12-19)8-10-15/h3-10H,2,11,13H2,1H3,(H,20,21) |
| InChIKey | DVTPWTZFCKROEI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |