C23H19ClN2OS — CID 112759044
N-[1-(3-chlorophenyl)ethyl]-2-[(4-cyanophenyl)methylsulfanyl]benzamide (PubChem CID 112759044) has the molecular formula C23H19ClN2OS and a molecular weight of 406.94 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-2-[(4-cyanophenyl)methylsulfanyl]benzamide.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-2-[(4-cyanophenyl)methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 112759044 |
| Molecular Formula | C23H19ClN2OS |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-2-[(4-cyanophenyl)methylsulfanyl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1SCc1ccc(C#N)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H19ClN2OS/c1-16(19-5-4-6-20(24)13-19)26-23(27)21-7-2-3-8-22(21)28-15-18-11-9-17(14-25)10-12-18/h2-13,16H,15H2,1H3,(H,26,27) |
| InChIKey | ODNIULCMNBLMTF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |