C25H24N2O2S — CID 8895673
2-[(4-cyanophenyl)methylsulfanyl]-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]benzamide (PubChem CID 8895673) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfanyl]-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]benzamide.
| Compound Name | 2-[(4-cyanophenyl)methylsulfanyl]-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 8895673 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfanyl]-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]benzamide |
| SMILES | COc1ccc(C)cc1[C@@H](C)NC(=O)c1ccccc1SCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C25H24N2O2S/c1-17-8-13-23(29-3)22(14-17)18(2)27-25(28)21-6-4-5-7-24(21)30-16-20-11-9-19(15-26)10-12-20/h4-14,18H,16H2,1-3H3,(H,27,28)/t18-/m1/s1 |
| InChIKey | FDNGZAIOYKCAJI-GOSISDBHSA-N |
| XLogP | 5.66 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |