C25H20N2O5S — CID 30310438
[2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 2-[(4-cyanophenyl)methylsulfanyl]benzoate (PubChem CID 30310438) has the molecular formula C25H20N2O5S and a molecular weight of 460.51 g/mol. Its IUPAC name is [2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 2-[(4-cyanophenyl)methylsulfanyl]benzoate.
| Compound Name | [2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 2-[(4-cyanophenyl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 30310438 |
| Molecular Formula | C25H20N2O5S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 2-[(4-cyanophenyl)methylsulfanyl]benzoate |
| SMILES | COc1ccc(C(=O)NC(=O)COC(=O)c2ccccc2SCc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C25H20N2O5S/c1-31-20-12-10-19(11-13-20)24(29)27-23(28)15-32-25(30)21-4-2-3-5-22(21)33-16-18-8-6-17(14-26)7-9-18/h2-13H,15-16H2,1H3,(H,27,28,29) |
| InChIKey | DEHIJQZFHBROPY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |