C20H20N2O4S — CID 7605629
(4-cyanophenyl)methyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 7605629) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | (4-cyanophenyl)methyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 7605629 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (4-cyanophenyl)methyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | COCCNC(=O)CSc1ccccc1C(=O)OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-25-11-10-22-19(23)14-27-18-5-3-2-4-17(18)20(24)26-13-16-8-6-15(12-21)7-9-16/h2-9H,10-11,13-14H2,1H3,(H,22,23) |
| InChIKey | OMGJOGVRKISCSJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|