C21H23NO6S — CID 42986577
[2-(4-methoxyphenyl)-2-oxoethyl] 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 42986577) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 42986577 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | COCCNC(=O)CSc1ccccc1C(=O)OCC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H23NO6S/c1-26-12-11-22-20(24)14-29-19-6-4-3-5-17(19)21(25)28-13-18(23)15-7-9-16(27-2)10-8-15/h3-10H,11-14H2,1-2H3,(H,22,24) |
| InChIKey | KDJKQGXFPBYSJF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|