C17H22N2O5S — CID 29174702
[2-(cyclopropylamino)-2-oxoethyl] 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 29174702) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 29174702 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | COCCNC(=O)CSc1ccccc1C(=O)OCC(=O)NC1CC1 |
| InChI | InChI=1S/C17H22N2O5S/c1-23-9-8-18-16(21)11-25-14-5-3-2-4-13(14)17(22)24-10-15(20)19-12-6-7-12/h2-5,12H,6-11H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | BXQNFJYJNYZOFA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|