C17H23NO3S — CID 16543862
[2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-methylsulfanylbenzoate (PubChem CID 16543862) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-methylsulfanylbenzoate.
| Compound Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 16543862 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 2-methylsulfanylbenzoate |
| SMILES | CSc1ccccc1C(=O)OCC(=O)NC1CCC(C)CC1 |
| InChI | InChI=1S/C17H23NO3S/c1-12-7-9-13(10-8-12)18-16(19)11-21-17(20)14-5-3-4-6-15(14)22-2/h3-6,12-13H,7-11H2,1-2H3,(H,18,19) |
| InChIKey | BCXLMBNPTGLFKJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |