C13H13NO3S — CID 8841118
[2-oxo-2-(prop-2-ynylamino)ethyl] 2-methylsulfanylbenzoate (PubChem CID 8841118) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 2-methylsulfanylbenzoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8841118 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-methylsulfanylbenzoate |
| SMILES | C#CCNC(=O)COC(=O)c1ccccc1SC |
| InChI | InChI=1S/C13H13NO3S/c1-3-8-14-12(15)9-17-13(16)10-6-4-5-7-11(10)18-2/h1,4-7H,8-9H2,2H3,(H,14,15) |
| InChIKey | WCCMOHQRVDCDRZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|