C17H15N3O6 — CID 9076352
bis[2-oxo-2-(prop-2-ynylamino)ethyl] pyridine-2,6-dicarboxylate (PubChem CID 9076352) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is bis[2-oxo-2-(prop-2-ynylamino)ethyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[2-oxo-2-(prop-2-ynylamino)ethyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 9076352 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | bis[2-oxo-2-(prop-2-ynylamino)ethyl] pyridine-2,6-dicarboxylate |
| SMILES | C#CCNC(=O)COC(=O)c1cccc(C(=O)OCC(=O)NCC#C)n1 |
| InChI | InChI=1S/C17H15N3O6/c1-3-8-18-14(21)10-25-16(23)12-6-5-7-13(20-12)17(24)26-11-15(22)19-9-4-2/h1-2,5-7H,8-11H2,(H,18,21)(H,19,22) |
| InChIKey | YKLASCNINNMKHW-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|