C16H14N2O3 — CID 8577430
[2-oxo-2-(prop-2-ynylamino)ethyl] 2-methylquinoline-4-carboxylate (PubChem CID 8577430) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 2-methylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 8577430 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-methylquinoline-4-carboxylate |
| SMILES | C#CCNC(=O)COC(=O)c1cc(C)nc2ccccc12 |
| InChI | InChI=1S/C16H14N2O3/c1-3-8-17-15(19)10-21-16(20)13-9-11(2)18-14-7-5-4-6-12(13)14/h1,4-7,9H,8,10H2,2H3,(H,17,19) |
| InChIKey | YOUIZMGROUGYOV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|