C18H21N3O4 — CID 8577440
[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 2-methylquinoline-4-carboxylate (PubChem CID 8577440) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 2-methylquinoline-4-carboxylate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 2-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 8577440 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 2-methylquinoline-4-carboxylate |
| SMILES | CCCNC(=O)CNC(=O)COC(=O)c1cc(C)nc2ccccc12 |
| InChI | InChI=1S/C18H21N3O4/c1-3-8-19-16(22)10-20-17(23)11-25-18(24)14-9-12(2)21-15-7-5-4-6-13(14)15/h4-7,9H,3,8,10-11H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | NEHZKEYJULGAMS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |