C22H22N2O4 — CID 9231199
[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] anthracene-9-carboxylate (PubChem CID 9231199) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] anthracene-9-carboxylate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 9231199 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] anthracene-9-carboxylate |
| SMILES | CCCNC(=O)CNC(=O)COC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C22H22N2O4/c1-2-11-23-19(25)13-24-20(26)14-28-22(27)21-17-9-5-3-7-15(17)12-16-8-4-6-10-18(16)21/h3-10,12H,2,11,13-14H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | RKZZWUBQAHZUSJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|